bis(4-nitrophenyl)phosphinic acid
Modify Date: 2024-01-12 20:01:42
bis(4-nitrophenyl)phosphinic acid structure
|
Common Name | bis(4-nitrophenyl)phosphinic acid | ||
|---|---|---|---|---|
| CAS Number | 105673-72-1 | Molecular Weight | 308.18300 | |
| Density | 1.56g/cm3 | Boiling Point | 609.8ºC at 760mmHg | |
| Molecular Formula | C12H9N2O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.6ºC | |
| Name | bis(4-nitrophenyl)phosphinic acid |
|---|
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 609.8ºC at 760mmHg |
| Molecular Formula | C12H9N2O6P |
| Molecular Weight | 308.18300 |
| Flash Point | 322.6ºC |
| Exact Mass | 308.02000 |
| PSA | 138.75000 |
| LogP | 2.77060 |
| Vapour Pressure | 1.01E-15mmHg at 25°C |
| Index of Refraction | 1.649 |
|
~%
bis(4-nitrophen... CAS#:105673-72-1 |
| Literature: Doak; Freedman Journal of the American Chemical Society, 1951 , vol. 73, p. 5658 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |