Name | N-Benzoyl-N'-(2,4,6-trichlor-phenyl)hydrazin |
---|---|
Synonyms |
N'-Benzoyl-N-2,4,6-trichlorphenylhydrazin
Benzoesaeure-[N'-(2,4,6-trichlor-phenyl)-hydrazid] N-(2.4.6-Trichlor-phenyl)-N'-benzoyl-hydrazin β-(2,4,6-Trichlorphenyl)-benzhydrazid benzoic acid-[N'-(2,4,6-trichloro-phenyl)-hydrazide] |
Molecular Formula | C13H9Cl3N2O |
---|---|
Molecular Weight | 315.58200 |
Exact Mass | 313.97800 |
PSA | 41.13000 |
LogP | 4.86760 |
HS Code | 2928000090 |
---|
Precursor 0 | |
---|---|
DownStream 1 | |
HS Code | 2928000090 |
---|---|
Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |