5338-94-3
5338-94-3 structure
- Name: 5,6-dimethyl-N-[(3-nitrophenyl)methylideneamino]-2-phenyl-pyrimidin-4-amine
- Chemical Name: 1-[4-(dimethylamino)phenyl]ethanol
- CAS Number: 5338-94-3
- Molecular Formula: C10H15NO
- Molecular Weight: 165.23200
- Create Date: 2017-09-15 12:45:11
- Modify Date: 2024-01-02 20:38:36
| Name | 1-[4-(dimethylamino)phenyl]ethanol |
|---|---|
| Synonyms |
1-<(Dimethylamino)phenyl>ethanol
1-Propanone,1-[4-(dimethylamino)phenyl]-2-methyl 1-(4-(dimethylamino)phenyl)-2-methylpropan-1-one (N,N-dimethylamino-4)phenyl-1 ethanol <p-Dimethylamino-phenyl>-isopropyl-keton p-(CH3)2NC6H4C(O)CH(CH3)2 p-N,N-Dimethylaminoisobutyrophenon 1-(4-(dimethylamino)phenyl)ethyl alcohol 1-<4-(N,N-dimethylamino)phenyl>-2-methylpropan-1-one 1-[4-(N,N-dimethylamino)phenyl]ethanol (4-Dimethylaminophenyl)-isopropylketon |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 283.2ºC at 760 mmHg |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.23200 |
| Flash Point | 135.3ºC |
| Exact Mass | 165.11500 |
| PSA | 23.47000 |
| LogP | 1.80590 |
| Index of Refraction | 1.565 |
| HS Code | 2922199090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |