65887-64-1
65887-64-1 structure
- Name: Phosphinic acid,di-2-furanyl- (9CI)
- Chemical Name: bis(furan-2-yl)phosphinic acid
- CAS Number: 65887-64-1
- Molecular Formula: C8H7O4P
- Molecular Weight: 198.11300
- Create Date: 2016-06-01 04:57:12
- Modify Date: 2024-01-26 18:15:12
| Name | bis(furan-2-yl)phosphinic acid |
|---|---|
| Synonyms |
Di-(2-furyl)-phosphinat
BIS(2-FURYL)PHOSPHINIC ACID di-furan-2-yl-phosphinic acid di-2-furanylphosphinic acid |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 425.2ºC at 760mmHg |
| Molecular Formula | C8H7O4P |
| Molecular Weight | 198.11300 |
| Flash Point | 210.9ºC |
| Exact Mass | 198.00800 |
| PSA | 73.39000 |
| LogP | 1.09380 |
| Index of Refraction | 1.558 |
|
~%
65887-64-1 |
| Literature: Clive; Kang Journal of Organic Chemistry, 2001 , vol. 66, # 18 p. 6083 - 6091 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![2-[chloro(furan-2-yl)phosphoryl]furan structure](https://www.chemsrc.com/caspic/311/93973-56-9.png)