6632-62-8
6632-62-8 structure
- Name: 1-Hexanamine,3,5,5-trimethyl-N-[1-(1-methylethyl)-2-propyn-1-yl]-
- Chemical Name: 3,5,5-trimethyl-N-(4-methylpent-1-yn-3-yl)hexan-1-amine
- CAS Number: 6632-62-8
- Molecular Formula: C15H29N
- Molecular Weight: 223.39700
- Create Date: 2017-07-16 03:27:18
- Modify Date: 2024-01-27 12:29:39
| Name | 3,5,5-trimethyl-N-(4-methylpent-1-yn-3-yl)hexan-1-amine |
|---|---|
| Synonyms |
(1-Isopropyl-prop-2-inyl)-(3,5,5-trimethyl-hexyl)-amin
N-(1-isopropylprop-2-ynyl)-3,5,5-trimethyl-hexan-1-amine (1-isopropyl-prop-2-ynyl)-(3,5,5-trimethyl-hexyl)-amine |
| Density | 0.827g/cm3 |
|---|---|
| Boiling Point | 293ºC at 760mmHg |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.39700 |
| Flash Point | 124.2ºC |
| Exact Mass | 223.23000 |
| PSA | 12.03000 |
| LogP | 4.08710 |
| Index of Refraction | 1.451 |
|
~%
6632-62-8 |
| Literature: Rohm and Haas Co. Patent: US2665311 , 1950 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |