6-[4-(methylamino)phenyl]quinoline-5,8-dione structure
|
Common Name | 6-[4-(methylamino)phenyl]quinoline-5,8-dione | ||
|---|---|---|---|---|
| CAS Number | 111928-33-7 | Molecular Weight | 264.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[4-(methylamino)phenyl]quinoline-5,8-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N2O2 |
|---|---|
| Molecular Weight | 264.27900 |
| Exact Mass | 264.09000 |
| PSA | 59.06000 |
| LogP | 2.65890 |
| InChIKey | FLJQRZARTUAMIO-UHFFFAOYSA-N |
| SMILES | CNc1ccc(C2=CC(=O)c3ncccc3C2=O)cc1 |
|
~11%
6-[4-(methylami... CAS#:111928-33-7 |
| Literature: Yoshida, Katsuhira; Ishiguro, Miwa; Honda, Hiroyuki; Yamamoto, Mayumi; Kubo, Yuji Bulletin of the Chemical Society of Japan, 1988 , vol. 61, # 12 p. 4335 - 4340 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,8-Quinolinedione,6-[4-(methylamino)phenyl] |
| 6-<p-(methylamino)phenyl>-5,8-quinolinedione |
| 6-(4-methylaminophenyl)-5,8-quinolinedione |
| 6-[p-(N-methylamino)phenyl]quinoline-5,8-dione |