Benzamide,N-(2-chlorophenyl)-3-fluoro-
Modify Date: 2024-01-09 19:10:00
Benzamide,N-(2-chlorophenyl)-3-fluoro- structure
|
Common Name | Benzamide,N-(2-chlorophenyl)-3-fluoro- | ||
|---|---|---|---|---|
| CAS Number | 1629-12-5 | Molecular Weight | 249.66800 | |
| Density | 1.353g/cm3 | Boiling Point | 282.4ºC at 760 mmHg | |
| Molecular Formula | C13H9ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.6ºC | |
| Name | N-(2-chlorophenyl)-3-fluorobenzamide |
|---|
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 282.4ºC at 760 mmHg |
| Molecular Formula | C13H9ClFNO |
| Molecular Weight | 249.66800 |
| Flash Point | 124.6ºC |
| Exact Mass | 249.03600 |
| PSA | 29.10000 |
| LogP | 3.80440 |
| Vapour Pressure | 0.00336mmHg at 25°C |
| Index of Refraction | 1.631 |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide,N-(2-... CAS#:1629-12-5 |
| Literature: Nayak, Susanta K.; Kishore Reddy; Row, Tayur N. Guru; Chopra, Deepak Crystal Growth and Design, 2011 , vol. 11, # 5 p. 1578 - 1596 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |