![]() Methyloxirane polymer with oxirane, ether with 2,4,7,9-tetramethyl-5-decyne-4,7-diol (2:1) structure
|
Common Name | Methyloxirane polymer with oxirane, ether with 2,4,7,9-tetramethyl-5-decyne-4,7-diol (2:1) | ||
---|---|---|---|---|
CAS Number | 182211-02-5 | Molecular Weight | N/A | |
Density | N/A | Boiling Point | N/A | |
Molecular Formula | C14H26O2.2(C3H6O)x.2(C2H4O)x | Melting Point | N/A | |
MSDS | N/A | Flash Point | N/A |
Name | Methyloxirane polymer with oxirane, ether with 2,4,7,9-tetramethyl-5-decyne-4,7-diol (2:1) |
---|
Molecular Formula | C14H26O2.2(C3H6O)x.2(C2H4O)x |
---|