N-(4-Chlorophenyl)-2-nitroaniline
Modify Date: 2024-01-10 11:58:34
N-(4-Chlorophenyl)-2-nitroaniline structure
|
Common Name | N-(4-Chlorophenyl)-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 23008-56-2 | Molecular Weight | 248.665 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 377.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C12H9ClN2O2 | Melting Point | 145-148 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 181.9±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(4-chlorophenyl)-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.2±27.0 °C at 760 mmHg |
| Melting Point | 145-148 °C(lit.) |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.665 |
| Flash Point | 181.9±23.7 °C |
| Exact Mass | 248.035248 |
| PSA | 57.85000 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.671 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921440000 |
CAS#:106-47-8
CAS#:88-73-3
CAS#:119-75-5
CAS#:127-09-3
CAS#:68817-71-0
CAS#:1226-23-9| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD02683544 |
| N-(4-Chlorophenyl)-2-nitroaniline |
| 4-Chloro-2'-nitrodiphenylamine |
| Benzenamine, N-(4-chlorophenyl)-2-nitro- |
| N-(4-Chlorophenyl)-2-nitrobenzenamine |
| EINECS 245-377-4 |