5-Nitro-2-phenylpyridine structure
|
Common Name | 5-Nitro-2-phenylpyridine | ||
|---|---|---|---|---|
| CAS Number | 4282-47-7 | Molecular Weight | 200.193 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 354.3±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H8N2O2 | Melting Point | 116-118ºC | |
| MSDS | N/A | Flash Point | 168.1±20.9 °C | |
| Name | 2-(4-Nitrophenyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.3±17.0 °C at 760 mmHg |
| Melting Point | 116-118ºC |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.193 |
| Flash Point | 168.1±20.9 °C |
| Exact Mass | 200.058578 |
| PSA | 58.71000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | FNLTWLXKZQWUJZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2ccccn2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(2-pyridinyl)nitrobenzene |
| 2-(p-Nitrophenyl)pyridine |
| 5-Nitro-2-phenylpyridine |
| 2-(4'-nitrophenyl)pyridine |
| 4-nitrophenylpyridine |
| 2-(4'-Nitrophenyl)piridine |
| 4-(2-pyridyl)nitrobenzene |
| MFCD04114193 |
| 2-(4-Nitrophenyl)pyridine |