5-(Dimethylamino)-6-ethyl-1-methyl-3-phenyluracil
Modify Date: 2025-10-27 12:18:48
5-(Dimethylamino)-6-ethyl-1-methyl-3-phenyluracil structure
|
Common Name | 5-(Dimethylamino)-6-ethyl-1-methyl-3-phenyluracil | ||
|---|---|---|---|---|
| CAS Number | 53727-42-7 | Molecular Weight | 273.33000 | |
| Density | 1.21g/cm3 | Boiling Point | 376.3ºC at 760 mmHg | |
| Molecular Formula | C15H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.3ºC | |
| Name | 5-(dimethylamino)-6-ethyl-1-methyl-3-phenylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 376.3ºC at 760 mmHg |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.33000 |
| Flash Point | 152.3ºC |
| Exact Mass | 273.14800 |
| PSA | 47.24000 |
| LogP | 1.16460 |
| Index of Refraction | 1.605 |
| InChIKey | VWEDCFSFEZGSKM-UHFFFAOYSA-N |
| SMILES | CCc1c(N(C)C)c(=O)n(-c2ccccc2)c(=O)n1C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Uracil,5-(dimethylamino)-6-ethyl-1-methyl-3-phenyl |
| 2,4(1H,3H)-Pyrimidinedione,5-(dimethylamino)-6-ethyl-1-methyl-3-phenyl |
| 5-dimethylamino-6-ethyl-1-methyl-3-phenyl-1H-pyrimidine-2,4-dione |
| 5-(Dimethylamino)-6-ethyl-1-methyl-3-phenyl-uracil |