N-(3-nitrobenzyl)cyclohexanamine
Modify Date: 2025-09-25 16:49:09
N-(3-nitrobenzyl)cyclohexanamine structure
|
Common Name | N-(3-nitrobenzyl)cyclohexanamine | ||
|---|---|---|---|---|
| CAS Number | 59507-50-5 | Molecular Weight | 234.29400 | |
| Density | 1.13g/cm3 | Boiling Point | 374.9ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.5ºC | |
| Name | N-[(3-nitrophenyl)methyl]cyclohexanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 374.9ºC at 760 mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.29400 |
| Flash Point | 180.5ºC |
| Exact Mass | 234.13700 |
| PSA | 57.85000 |
| LogP | 3.93120 |
| Index of Refraction | 1.56 |
| InChIKey | ATQVNKQVUGCPIF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(CNC2CCCCC2)c1 |
| HS Code | 2921499090 |
|---|
|
~88%
N-(3-nitrobenzy... CAS#:59507-50-5 |
| Literature: Ranu, Brindaban C.; Majee, Adinath; Sarkar, Arunkanti Journal of Organic Chemistry, 1998 , vol. 63, # 2 p. 370 - 373 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-(3-nitrobenzyl)cyclohexanamine |
| Cyclohexyl-(3-nitro-benzyl)-amine |
| N-(3-nitrobenzyl)cyclohexylamine |