Phosphorothioic acid, O,O,O-tris(3-methylphenyl)ester
Modify Date: 2024-02-01 17:14:15
Phosphorothioic acid, O,O,O-tris(3-methylphenyl)ester structure
|
Common Name | Phosphorothioic acid, O,O,O-tris(3-methylphenyl)ester | ||
|---|---|---|---|---|
| CAS Number | 597-81-9 | Molecular Weight | 384.42800 | |
| Density | 1.222g/cm3 | Boiling Point | 483.4ºC at 760mmHg | |
| Molecular Formula | C21H21O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.2ºC | |
| Name | tris(2-methylbenzyl) phosphorothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 483.4ºC at 760mmHg |
| Molecular Formula | C21H21O3PS |
| Molecular Weight | 384.42800 |
| Flash Point | 246.2ºC |
| Exact Mass | 384.09500 |
| PSA | 69.59000 |
| LogP | 7.02370 |
| Index of Refraction | 1.612 |
| HS Code | 2920190090 |
|---|
|
~%
Phosphorothioic... CAS#:597-81-9 |
| Literature: Broeker Journal fuer Praktische Chemie (Leipzig), 1928 , vol. <2> 118, p. 288 |
|
~%
Phosphorothioic... CAS#:597-81-9 |
| Literature: Yamasaki Sci. Rep. Res. Inst. Tohoku Univ., 1954 , vol. 6, p. 172,176 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| thiophosphoric acid O,O',O''-tri-m-tolyl ester |
| phosphorothioic acid,O,O,O-tris(3-methylphenyl) ester |
| Thiophosphorsaeure-O-(4-chlor-3-nitro-phenylester)-O',O''-dimethylester |
| Isochlorthion |
| O-(4-Chloro-3-nitrophenyl) O,O-dimethyl phosphorothioate |
| (4-CHLORO-3-NITRO-PHENOXY)-DIMETHOXY-SULFANYLIDENE-PHOSPHORANE |
| Phosphorothioic acid,O-(4-chloro-3-nitrophenyl) O,O-dimethyl ester |
| Thiophosphorsaeure-O,O',O''-tri-m-tolylester |
| O.O.O-Tri-m-tolylthiophosphat |
| Phosnichlor [ISO:BSI] |
| Phosnichlor |
| thiophosphoric acid O-(4-chloro-3-nitro-phenyl ester)-O',O''-dimethyl ester |