N-(2-chlorophenyl)-2-oxo-1,3-diaza-2$l^C9H13ClN3OP-phosphacyclohexan-2-amine
Modify Date: 2024-01-23 16:43:05
N-(2-chlorophenyl)-2-oxo-1,3-diaza-2$l^C9H13ClN3OP-phosphacyclohexan-2-amine structure
|
Common Name | N-(2-chlorophenyl)-2-oxo-1,3-diaza-2$l^C9H13ClN3OP-phosphacyclohexan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 7154-61-2 | Molecular Weight | 245.64600 | |
| Density | 1.35g/cm3 | Boiling Point | 353.8ºC at 760 mmHg | |
| Molecular Formula | C9H13ClN3OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.8ºC | |
| Name | 4-(4-methylphenyl)-4-propan-2-yloxybutanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 353.8ºC at 760 mmHg |
| Molecular Formula | C9H13ClN3OP |
| Molecular Weight | 245.64600 |
| Flash Point | 167.8ºC |
| Exact Mass | 245.04800 |
| PSA | 62.97000 |
| LogP | 3.17350 |
| Index of Refraction | 1.59 |
|
~%
N-(2-chlorophen... CAS#:7154-61-2 |
| Literature: Billman,J.H. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 366 - 367 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-<N-(o-Chlor-phenyl)-amino>-1.3.2-diazaphosphorinan-2-oxid |
| 4-(4-methylphenyl)-4-(propan-2-yloxy)butanenitrile |
| EINECS 230-174-5 |