Tri-n-butylphenyltin structure
|
Common Name | Tri-n-butylphenyltin | ||
|---|---|---|---|---|
| CAS Number | 960-16-7 | Molecular Weight | 367.14800 | |
| Density | 1.125 g/mL at 25 °C(lit.) | Boiling Point | 125-128ºC0.14 mm Hg(lit.) | |
| Molecular Formula | C18H32Sn | Melting Point | <0ºC | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | Tributylphenyltin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.125 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 125-128ºC0.14 mm Hg(lit.) |
| Melting Point | <0ºC |
| Molecular Formula | C18H32Sn |
| Molecular Weight | 367.14800 |
| Flash Point | >230 °F |
| Exact Mass | 368.15300 |
| LogP | 5.74270 |
| Index of Refraction | n20/D 1.516(lit.) |
| InChIKey | SYUVAXDZVWPKSI-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccc1 |
| Water Solubility | Sparingly Soluble (9.9E-5 g/L) (25°C) |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H319-H372-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P314-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R21;R25;R36/38;R48/23/25;R50/53 |
| Safety Phrases | S35-S36/37/39-S45-S60-S61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
J.K. Stille
Angew. Chem. Int. Ed. Engl. 98 , 504, (1986)
|
|
|
M. Kosugi et al.
Bull. Chem. Soc. Jpn. 59 , 677, (1986)
|
|
|
A.M. Echavarren, J.K. Stille
J. Am. Chem. Soc. 110 , 4039, (1988)
|
| MFCD00134394 |
| tributyl(phenyl)stannane |