| Name | (1S,2R)-1,2-dimethylcyclohexane |
|---|---|
| Synonyms |
cis-1,2-Dimethylcyclohexane
Z-1,2-dimethylcyclohexane meso-cis-1,2-dimethylcyclohexane 1,cis-2-Dimethylcyclohexane 1,2-cis-dimethylcyclohexane Cyclohexane,1,2-dimethyl-,cis InChI=1/C8H16/c1-7-5-3-4-6-8(7)2/h7-8H,3-6H2,1-2H3/t7-,8 (1R,2S)-1,2-Dimethylcyclohexane EINECS 218-621-2 MFCD00063621 cis-Hexahydro-o-xylene cyclohexane,1,2-dimethyl-,(1R,2S) cis-1,2-dimethyl-cyclohexane |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 125.9±7.0 °C at 760 mmHg |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.213 |
| Flash Point | 15.6±0.0 °C |
| Exact Mass | 112.125198 |
| LogP | 4.37 |
| Vapour Pressure | 14.5±0.1 mmHg at 25°C |
| Index of Refraction | 1.420 |
| Hazard Codes | F,Xn |
|---|---|
| Risk Phrases | 11-65 |
| Safety Phrases | 9-16-33-62 |
| RIDADR | UN 2263 3/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| HS Code | 2902199090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2902199090 |
|---|---|
| Summary | 2902199090 other cyclanes, cyclenes and cyclotherpenes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |