Name | 2,2-Dibromo-1-(4-chlorophenyl)ethanone |
---|---|
Synonyms |
Ethanone,2,2-dibromo-1-(4-chlorophenyl)
2,2-Dibrom-1-(4-chlor-phenyl)-aethanon InChI=1/C8H5Br2ClO/c9-8(10)7(12)5-1-3-6(11)4-2-5/h1-4,8 2,2-BIS-(4-FLUOROPHENYL)-TETRAHYDROFURAN 2,2-dibromo-1-(4'-chlorophenyl)ethanone 2,2-Dibrom-1-(4-chlor-phenyl)-aethanon-(1) 2,2-dibromo-1-(4-chloro-phenyl)-ethanone-(1) 2,2-dibromo-4'-chloroacetophenone |
Molecular Formula | C8H5Br2ClO |
---|---|
Molecular Weight | 312.38600 |
Exact Mass | 309.84000 |
PSA | 17.07000 |
LogP | 3.63860 |
HS Code | 2914700090 |
---|
Precursor 6 | |
---|---|
DownStream 6 | |
HS Code | 2914700090 |
---|---|
Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |