128800-56-6
128800-56-6 structure
- Name: Methyl 2,4-dichloro-5-fluorobenzoate
- Chemical Name: Methyl 2,4-dichloro-5-fluorobenzoate
- CAS Number: 128800-56-6
- Molecular Formula: C8H5Cl2FO2
- Molecular Weight: 223.02900
- Catalog: Organic raw materials Organic fluorine compound Fluorobenzoic acid series
- Create Date: 2018-06-24 17:19:08
- Modify Date: 2024-01-05 19:49:39
| Name | Methyl 2,4-dichloro-5-fluorobenzoate |
|---|---|
| Synonyms |
InChI=1/C8H5Cl2FO2/c1-13-8(12)4-2-7(11)6(10)3-5(4)9/h2-3H,1H
MFCD00192287 |
| Density | 1.448 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 268.1ºC at 760 mmHg |
| Molecular Formula | C8H5Cl2FO2 |
| Molecular Weight | 223.02900 |
| Flash Point | >230 °F |
| Exact Mass | 221.96500 |
| PSA | 26.30000 |
| LogP | 2.91910 |
| Vapour Pressure | 0.00783mmHg at 25°C |
| Index of Refraction | n20/D 1.539(lit.) |
| WGK Germany | 3 |
|---|---|
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |