10560-52-8
10560-52-8 structure
- Name: Acetamide,N-(2-chlorophenyl)-N-nitroso-
- Chemical Name: acetic acid-(2-chloro-N-nitroso-anilide)
- CAS Number: 10560-52-8
- Molecular Formula: C8H7ClN2O2
- Molecular Weight: 198.60600
- Create Date: 2016-09-20 19:44:37
- Modify Date: 2024-04-03 17:56:09
| Name | acetic acid-(2-chloro-N-nitroso-anilide) |
|---|---|
| Synonyms |
N-Acetyl-N-nitroso-2-chlor-anilin
o-Chlor-N-Nitrosoacetanilid N-Nitroso-2-chlor-acetanilid |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 273.7ºC at 760mmHg |
| Molecular Formula | C8H7ClN2O2 |
| Molecular Weight | 198.60600 |
| Flash Point | 119.3ºC |
| Exact Mass | 198.02000 |
| PSA | 49.74000 |
| LogP | 2.37430 |
| Vapour Pressure | 0.00565mmHg at 25°C |
| Index of Refraction | 1.574 |
|
~%
10560-52-8 |
| Literature: Haworth; Hey Journal of the Chemical Society, 1940 , p. 361,368 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![2-Naphthalenol,1-[2-(2-chlorophenyl)diazenyl]- structure](https://image.chemsrc.com/caspic/201/24390-65-6.png)