33744-74-0
33744-74-0 structure
- Name: (-)-LUPININE
- Chemical Name: 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylbenzoic acid
- CAS Number: 33744-74-0
- Molecular Formula: C18H24O4
- Molecular Weight: 304.38100
- Create Date: 2018-08-20 05:57:34
- Modify Date: 2024-01-16 07:44:30
| Name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylbenzoic acid |
|---|---|
| Synonyms |
monomenthyl (-)-phthalate
2-({[(1R,2S,5R)-2-isopropyl-5-methylcyclohexyl]oxy}carbonyl)benzoic acid (-)-mono-(1R)-Menthyl phthalate phthalic acid mono-((1R)-menthyl ester) (1R,2S,5R)-(-)-menthyl (2-carboxy)benzoate InChI=1/C18H24O4/c1-11(2)13-9-8-12(3)10-16(13)22-18(21)15-7-5-4-6-14(15)17(19)20/h4-7,11-13,16H,8-10H2,1-3H3,(H,19,20)/t12-,13+,16-/m1/s 1,2-benzenedicarboxylic acid,mono[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester menthyl hydrogen phthalate Phthalsaeure-mono-((1R)-menthylester) (1R,3R,4S)-p-menthan-3-yl hydrogen phthalate MFCD00077849 1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexylhydrogen benzene-1,2-dicarboxylate |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760mmHg |
| Melting Point | 103-108ºC(lit.) |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.38100 |
| Flash Point | 152.2ºC |
| Exact Mass | 304.16700 |
| PSA | 63.60000 |
| LogP | 4.00240 |
| Index of Refraction | 1.538 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |