7-Oxotridecanedioic acid structure
|
Common Name | 7-Oxotridecanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 101171-43-1 | Molecular Weight | 258.31100 | |
| Density | 1.125g/cm3 | Boiling Point | 490.2ºC at 760 mmHg | |
| Molecular Formula | C13H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.4ºC | |
Use of 7-Oxotridecanedioic acid7-Oxotridecanedioic acid is a biodegradable cationic lipid intermediate compound for lipid nanoparticles formation. 7-Oxotridecanedioic acid can be incorporated into a lipid particle for delivering active agents[1]. |
| Name | 7-Oxotridecanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Oxotridecanedioic acid is a biodegradable cationic lipid intermediate compound for lipid nanoparticles formation. 7-Oxotridecanedioic acid can be incorporated into a lipid particle for delivering active agents[1]. |
|---|---|
| Related Catalog | |
| In Vitro | These cationic lipids can be incorporated into a lipid particle for delivering an active agent, such as a nucleic acid. 7-Oxotridecanedioic acid is extracted from patent US20150005363, intermediate 12[1]. |
| References |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 490.2ºC at 760 mmHg |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31100 |
| Flash Point | 264.4ºC |
| Exact Mass | 258.14700 |
| PSA | 91.67000 |
| LogP | 2.62570 |
| Vapour Pressure | 5.96E-11mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | OETDBDZZHBMHQQ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCC(=O)CCCCCC(=O)O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 7-oxo-trideca-2(Z),11(Z)-diene dinitrile |
| 7-oxo-trideca-2,11-dienedinitrile |
| 7-oxo-tridecane-1,13-dioic acid |
| 7-oxo-tridecanedioic acid |
| (2Z,11Z)-7-oxotrideca-2,11-dienedinitrile |
| 7-Oxo-tridecandisaeure |
| (Z,Z)-tridecan-2,11-diene-7-one-1,13-dinitrile |
| 2,11-Tridecadienedinitrile,7-oxo-,(2Z,11Z) |