2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid structure
|
Common Name | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 413624-71-2 | Molecular Weight | 342.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H34O5 | Melting Point | 82 - 83 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid is a ketone compound extracted from patent WO2002030860A2, compound example II-9. 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid can be used for the research of cardiovascular diseases, dyslipidemias, dysproteinemias, and glucose metabolism disorders[1]. |
| Name | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid is a ketone compound extracted from patent WO2002030860A2, compound example II-9. 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid can be used for the research of cardiovascular diseases, dyslipidemias, dysproteinemias, and glucose metabolism disorders[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 82 - 83 °C |
|---|---|
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.47 |
| InChIKey | NHVXRVOYVVPVDU-UHFFFAOYSA-N |
| SMILES | CC(C)(CCCCCC(=O)CCCCCC(C)(C)C(=O)O)C(=O)O |
| Storage condition | 2-8°C |
| MFCD30608825 |